ChemNet > CAS > 92658-77-0 1-[1-(5-methylisoxazol-3-yl)-1H-1,2,4-triazol-3-yl]acetone
92658-77-0 1-[1-(5-methylisoxazol-3-yl)-1H-1,2,4-triazol-3-yl]acetone
| Produkt-Name |
1-[1-(5-methylisoxazol-3-yl)-1H-1,2,4-triazol-3-yl]acetone |
| Englischer Name |
1-[1-(5-methylisoxazol-3-yl)-1H-1,2,4-triazol-3-yl]acetone;1-[1-(5-methyl-1,2-oxazol-3-yl)-1H-1,2,4-triazol-3-yl]propan-2-one |
| Molekulare Formel |
C9H10N4O2 |
| Molecular Weight |
206.2013 |
| InChI |
InChI=1/C9H10N4O2/c1-6(14)3-8-10-5-13(11-8)9-4-7(2)15-12-9/h4-5H,3H2,1-2H3 |
| CAS Registry Number |
92658-77-0 |
| Molecular Structure |
![92658-77-0 1-[1-(5-methylisoxazol-3-yl)-1H-1,2,4-triazol-3-yl]acetone](https://images-a.chemnet.com/suppliers/chembase/cas11/cas92658-77-0.gif)
|
| Dichte |
1.39g/cm3 |
| Schmelzpunkt |
138℃ |
| Siedepunkt |
439°C at 760 mmHg |
| Brechungsindex |
1.652 |
| Flammpunkt |
219.3°C |
| Dampfdruck |
6.61E-08mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
